C18H19F2N3O5S — CID 3862990
dimethyl 3-[4-[[2-(difluoromethylsulfanyl)benzoyl]amino]pyrazol-1-yl]pentanedioate (PubChem CID 3862990) has the molecular formula C18H19F2N3O5S and a molecular weight of 427.43 g/mol. Its IUPAC name is dimethyl 3-[4-[[2-(difluoromethylsulfanyl)benzoyl]amino]pyrazol-1-yl]pentanedioate.
| Compound Name | dimethyl 3-[4-[[2-(difluoromethylsulfanyl)benzoyl]amino]pyrazol-1-yl]pentanedioate |
|---|---|
| PubChem CID | 3862990 |
| Molecular Formula | C18H19F2N3O5S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | dimethyl 3-[4-[[2-(difluoromethylsulfanyl)benzoyl]amino]pyrazol-1-yl]pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)n1cc(NC(=O)c2ccccc2SC(F)F)cn1 |
| InChI | InChI=1S/C18H19F2N3O5S/c1-27-15(24)7-12(8-16(25)28-2)23-10-11(9-21-23)22-17(26)13-5-3-4-6-14(13)29-18(19)20/h3-6,9-10,12,18H,7-8H2,1-2H3,(H,22,26) |
| InChIKey | CXQSRLDGNFSONT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |