C16H19N3O6S — CID 3848159
dimethyl 3-[4-[(4-methoxythiophene-3-carbonyl)amino]pyrazol-1-yl]pentanedioate (PubChem CID 3848159) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is dimethyl 3-[4-[(4-methoxythiophene-3-carbonyl)amino]pyrazol-1-yl]pentanedioate.
| Compound Name | dimethyl 3-[4-[(4-methoxythiophene-3-carbonyl)amino]pyrazol-1-yl]pentanedioate |
|---|---|
| PubChem CID | 3848159 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | dimethyl 3-[4-[(4-methoxythiophene-3-carbonyl)amino]pyrazol-1-yl]pentanedioate |
| SMILES | COC(=O)CC(CC(=O)OC)n1cc(NC(=O)c2cscc2OC)cn1 |
| InChI | InChI=1S/C16H19N3O6S/c1-23-13-9-26-8-12(13)16(22)18-10-6-17-19(7-10)11(4-14(20)24-2)5-15(21)25-3/h6-9,11H,4-5H2,1-3H3,(H,18,22) |
| InChIKey | VOVCZGHKCLPRJF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |