C22H16ClNO5S — CID 3802181
ethyl 4-[5-[2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 3802181) has the molecular formula C22H16ClNO5S and a molecular weight of 441.89 g/mol. Its IUPAC name is ethyl 4-[5-[2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3802181 |
| Molecular Formula | C22H16ClNO5S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | ethyl 4-[5-[2-(4-chlorophenyl)sulfonyl-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C(C#N)S(=O)(=O)c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C22H16ClNO5S/c1-2-28-22(25)16-5-3-15(4-6-16)21-12-9-18(29-21)13-20(14-24)30(26,27)19-10-7-17(23)8-11-19/h3-13H,2H2,1H3 |
| InChIKey | LLMTXLXTKZPTFK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 97.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|