C26H24N2O5 — CID 38025161
N-[1-(furan-3-carbonyl)piperidin-4-yl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide (PubChem CID 38025161) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is N-[1-(furan-3-carbonyl)piperidin-4-yl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide.
| Compound Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 38025161 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-5-(naphthalen-2-yloxymethyl)furan-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1ccc(COc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C26H24N2O5/c29-25(27-21-9-12-28(13-10-21)26(30)20-11-14-31-16-20)24-8-7-23(33-24)17-32-22-6-5-18-3-1-2-4-19(18)15-22/h1-8,11,14-16,21H,9-10,12-13,17H2,(H,27,29) |
| InChIKey | OTTGSPIAZOEVSG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |