C23H36N2O4S — CID 38027639
2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 38027639) has the molecular formula C23H36N2O4S and a molecular weight of 436.62 g/mol. Its IUPAC name is 2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 38027639 |
| Molecular Formula | C23H36N2O4S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-[(1S,4S,5S)-4-[(benzylsulfonylamino)methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1C[C@@H](C(C)C)[C@H](CNS(=O)(=O)Cc2ccccc2)C=C1C |
| InChI | InChI=1S/C23H36N2O4S/c1-17(2)22-13-20(14-23(26)24-10-11-29-4)18(3)12-21(22)15-25-30(27,28)16-19-8-6-5-7-9-19/h5-9,12,17,20-22,25H,10-11,13-16H2,1-4H3,(H,24,26)/t20-,21-,22-/m0/s1 |
| InChIKey | UBNXQVIDSUCQEO-FKBYEOEOSA-N |
| XLogP | 3.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|