C20H23BrN4O3S — CID 38029616
(2-bromo-5-pyrrolidin-1-ylsulfonylphenyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone (PubChem CID 38029616) has the molecular formula C20H23BrN4O3S and a molecular weight of 479.40 g/mol. Its IUPAC name is (2-bromo-5-pyrrolidin-1-ylsulfonylphenyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone.
| Compound Name | (2-bromo-5-pyrrolidin-1-ylsulfonylphenyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 38029616 |
| Molecular Formula | C20H23BrN4O3S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | (2-bromo-5-pyrrolidin-1-ylsulfonylphenyl)-(4-pyridin-4-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCCC2)ccc1Br)N1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C20H23BrN4O3S/c21-19-4-3-17(29(27,28)25-9-1-2-10-25)15-18(19)20(26)24-13-11-23(12-14-24)16-5-7-22-8-6-16/h3-8,15H,1-2,9-14H2 |
| InChIKey | KUXJXKJJASJLMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |