C21H29F3N4O2 — CID 3804904
1-[1-(4-ethylpiperazine-1-carbonyl)cyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 3804904) has the molecular formula C21H29F3N4O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 1-[1-(4-ethylpiperazine-1-carbonyl)cyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[1-(4-ethylpiperazine-1-carbonyl)cyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 3804904 |
| Molecular Formula | C21H29F3N4O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[1-(4-ethylpiperazine-1-carbonyl)cyclohexyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCN1CCN(C(=O)C2(NC(=O)Nc3ccccc3C(F)(F)F)CCCCC2)CC1 |
| InChI | InChI=1S/C21H29F3N4O2/c1-2-27-12-14-28(15-13-27)18(29)20(10-6-3-7-11-20)26-19(30)25-17-9-5-4-8-16(17)21(22,23)24/h4-5,8-9H,2-3,6-7,10-15H2,1H3,(H2,25,26,30) |
| InChIKey | JZCZMDKHHYXHDA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |