C22H32N4O2 — CID 1444537
1-[1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclohexyl]-3-(2-methylphenyl)urea (PubChem CID 1444537) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclohexyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclohexyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 1444537 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-[1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]cyclohexyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NC1(C(=O)N2CCN3CCC[C@H]3C2)CCCCC1 |
| InChI | InChI=1S/C22H32N4O2/c1-17-8-3-4-10-19(17)23-21(28)24-22(11-5-2-6-12-22)20(27)26-15-14-25-13-7-9-18(25)16-26/h3-4,8,10,18H,2,5-7,9,11-16H2,1H3,(H2,23,24,28)/t18-/m0/s1 |
| InChIKey | LPYZIZBAZXMNHW-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |