C20H23N3OS2 — CID 3808346
[2-oxo-2-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]ethyl] benzenecarbodithioate (PubChem CID 3808346) has the molecular formula C20H23N3OS2 and a molecular weight of 385.56 g/mol. Its IUPAC name is [2-oxo-2-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]ethyl] benzenecarbodithioate.
| Compound Name | [2-oxo-2-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]ethyl] benzenecarbodithioate |
|---|---|
| PubChem CID | 3808346 |
| Molecular Formula | C20H23N3OS2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2-oxo-2-[4-(pyridin-2-ylmethyl)-1,4-diazepan-1-yl]ethyl] benzenecarbodithioate |
| SMILES | O=C(CSC(=S)c1ccccc1)N1CCCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C20H23N3OS2/c24-19(16-26-20(25)17-7-2-1-3-8-17)23-12-6-11-22(13-14-23)15-18-9-4-5-10-21-18/h1-5,7-10H,6,11-16H2 |
| InChIKey | JKLFAKXHGMLROD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|