C14H19N3O4 — CID 3810996
[4-(but-2-ynoxycarbonylamino)pyrazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 3810996) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is [4-(but-2-ynoxycarbonylamino)pyrazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-(but-2-ynoxycarbonylamino)pyrazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 3810996 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [4-(but-2-ynoxycarbonylamino)pyrazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC#CCOC(=O)Nc1cnn(COC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H19N3O4/c1-5-6-7-20-13(19)16-11-8-15-17(9-11)10-21-12(18)14(2,3)4/h8-9H,7,10H2,1-4H3,(H,16,19) |
| InChIKey | VKGMETDOAHGRLD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|