C20H25N3O3S — CID 74225649
[4-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]pyrazol-1-yl]methyl 2,2-dimethylpropanoate (PubChem CID 74225649) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is [4-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]pyrazol-1-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]pyrazol-1-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 74225649 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [4-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]pyrazol-1-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCn1cc(NC(=O)CCS/C=C\c2ccccc2)cn1 |
| InChI | InChI=1S/C20H25N3O3S/c1-20(2,3)19(25)26-15-23-14-17(13-21-23)22-18(24)10-12-27-11-9-16-7-5-4-6-8-16/h4-9,11,13-14H,10,12,15H2,1-3H3,(H,22,24)/b11-9- |
| InChIKey | MYQRLRRKCJHYEG-LUAWRHEFSA-N |
| XLogP | 4.16 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|