C20H22N2O3S-2 — CID 159115550
amino-[4-[2-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]ethyl]phenyl]methanediolate (PubChem CID 159115550) has the molecular formula C20H22N2O3S-2 and a molecular weight of 370.47 g/mol. Its IUPAC name is amino-[4-[2-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]ethyl]phenyl]methanediolate.
| Compound Name | amino-[4-[2-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]ethyl]phenyl]methanediolate |
|---|---|
| PubChem CID | 159115550 |
| Molecular Formula | C20H22N2O3S-2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | amino-[4-[2-[3-[(Z)-2-phenylethenyl]sulfanylpropanoylamino]ethyl]phenyl]methanediolate |
| SMILES | NC([O-])([O-])c1ccc(CCNC(=O)CCS/C=C\c2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O3S/c21-20(24,25)18-8-6-17(7-9-18)10-13-22-19(23)12-15-26-14-11-16-4-2-1-3-5-16/h1-9,11,14H,10,12-13,15,21H2,(H,22,23)/q-2/b14-11- |
| InChIKey | KFAMKPBUXGGJPI-KAMYIIQDSA-N |
| XLogP | 0.93 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|