C18H17ClN2O7S — CID 38112399
methyl 3-[2-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonylamino]ethoxy]benzoate (PubChem CID 38112399) has the molecular formula C18H17ClN2O7S and a molecular weight of 440.86 g/mol. Its IUPAC name is methyl 3-[2-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonylamino]ethoxy]benzoate.
| Compound Name | methyl 3-[2-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonylamino]ethoxy]benzoate |
|---|---|
| PubChem CID | 38112399 |
| Molecular Formula | C18H17ClN2O7S |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | methyl 3-[2-[(6-chloro-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonylamino]ethoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCNS(=O)(=O)c2cc3c(cc2Cl)NC(=O)CO3)c1 |
| InChI | InChI=1S/C18H17ClN2O7S/c1-26-18(23)11-3-2-4-12(7-11)27-6-5-20-29(24,25)16-9-15-14(8-13(16)19)21-17(22)10-28-15/h2-4,7-9,20H,5-6,10H2,1H3,(H,21,22) |
| InChIKey | DYFOXKQPMMISEZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|