C16H13ClN2O6S — CID 55682260
(4-acetamidophenyl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate (PubChem CID 55682260) has the molecular formula C16H13ClN2O6S and a molecular weight of 396.81 g/mol. Its IUPAC name is (4-acetamidophenyl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate.
| Compound Name | (4-acetamidophenyl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
|---|---|
| PubChem CID | 55682260 |
| Molecular Formula | C16H13ClN2O6S |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | (4-acetamidophenyl) 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)c2cc3c(cc2Cl)NC(=O)CO3)cc1 |
| InChI | InChI=1S/C16H13ClN2O6S/c1-9(20)18-10-2-4-11(5-3-10)25-26(22,23)15-7-14-13(6-12(15)17)19-16(21)8-24-14/h2-7H,8H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | HMKQJESAMVHMLA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|