C16H8ClF6NO5S — CID 55682181
[3,5-bis(trifluoromethyl)phenyl] 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate (PubChem CID 55682181) has the molecular formula C16H8ClF6NO5S and a molecular weight of 475.75 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl] 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl] 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
|---|---|
| PubChem CID | 55682181 |
| Molecular Formula | C16H8ClF6NO5S |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl] 6-chloro-3-oxo-4H-1,4-benzoxazine-7-sulfonate |
| SMILES | O=C1COc2cc(S(=O)(=O)Oc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c(Cl)cc2N1 |
| InChI | InChI=1S/C16H8ClF6NO5S/c17-10-4-11-12(28-6-14(25)24-11)5-13(10)30(26,27)29-9-2-7(15(18,19)20)1-8(3-9)16(21,22)23/h1-5H,6H2,(H,24,25) |
| InChIKey | RMNKJUIAUIVVOP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|