C22H18N2OS2 — CID 38113839
[4-[(2-benzylsulfanylbenzoyl)amino]-3-methylphenyl] thiocyanate (PubChem CID 38113839) has the molecular formula C22H18N2OS2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [4-[(2-benzylsulfanylbenzoyl)amino]-3-methylphenyl] thiocyanate.
| Compound Name | [4-[(2-benzylsulfanylbenzoyl)amino]-3-methylphenyl] thiocyanate |
|---|---|
| PubChem CID | 38113839 |
| Molecular Formula | C22H18N2OS2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [4-[(2-benzylsulfanylbenzoyl)amino]-3-methylphenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)c1ccccc1SCc1ccccc1 |
| InChI | InChI=1S/C22H18N2OS2/c1-16-13-18(27-15-23)11-12-20(16)24-22(25)19-9-5-6-10-21(19)26-14-17-7-3-2-4-8-17/h2-13H,14H2,1H3,(H,24,25) |
| InChIKey | VTPHCWQMROEGPA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|