C15H24N2O3S — CID 38114249
N-[2-(3,4-dimethylphenoxy)ethyl]piperidine-1-sulfonamide (PubChem CID 38114249) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenoxy)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[2-(3,4-dimethylphenoxy)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 38114249 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[2-(3,4-dimethylphenoxy)ethyl]piperidine-1-sulfonamide |
| SMILES | Cc1ccc(OCCNS(=O)(=O)N2CCCCC2)cc1C |
| InChI | InChI=1S/C15H24N2O3S/c1-13-6-7-15(12-14(13)2)20-11-8-16-21(18,19)17-9-4-3-5-10-17/h6-7,12,16H,3-5,8-11H2,1-2H3 |
| InChIKey | BVILGLBHJUBQIK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|