About N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide
N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 38139186) has the molecular formula C21H22N2OS2
and a molecular weight of 382.55 g/mol. Its IUPAC name is N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 38139186 |
| Molecular Formula | C21H22N2OS2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H22N2OS2/c24-19(13-17-14-26-20(23-17)18-9-6-12-25-18)22-15-21(10-4-5-11-21)16-7-2-1-3-8-16/h1-3,6-9,12,14H,4-5,10-11,13,15H2,(H,22,24) |
| InChIKey | UZGMOSQWXYPTHQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide (CID 38139186) is N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide is O=C(Cc1csc(-c2cccs2)n1)NCC1(c2ccccc2)CCCC1.
What is the InChIKey of N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
The InChIKey is UZGMOSQWXYPTHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2OS2/c24-19(13-17-14-26-20(23-17)18-9-6-12-25-18)22-15-21(10-4-5-11-21)16-7-2-1-3-8-16/h1-3,6-9,12,14H,4-5,10-11,13,15H2,(H,22,24).
What are the key properties of N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide?
N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide has a molecular weight of 382.55 g/mol, XLogP of 5.04, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-phenylcyclopentyl)methyl]-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 38139186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).