C22H25N5O4S — CID 3815276
[4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]imidazol-2-yl]piperidin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone (PubChem CID 3815276) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is [4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]imidazol-2-yl]piperidin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone.
| Compound Name | [4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]imidazol-2-yl]piperidin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 3815276 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [4-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]imidazol-2-yl]piperidin-1-yl]-(4-methylsulfanyl-3-nitrophenyl)methanone |
| SMILES | CSc1ccc(C(=O)N2CCC(c3nccn3Cc3c(C)noc3C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H25N5O4S/c1-14-18(15(2)31-24-14)13-26-11-8-23-21(26)16-6-9-25(10-7-16)22(28)17-4-5-20(32-3)19(12-17)27(29)30/h4-5,8,11-12,16H,6-7,9-10,13H2,1-3H3 |
| InChIKey | XULNASUNPLVWOS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 107.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|