C26H31ClN4O3 — CID 38158370
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-ethoxyphenyl)propyl]piperidine-4-carboxamide (PubChem CID 38158370) has the molecular formula C26H31ClN4O3 and a molecular weight of 483.01 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-ethoxyphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-ethoxyphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38158370 |
| Molecular Formula | C26H31ClN4O3 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-[3-(4-ethoxyphenyl)propyl]piperidine-4-carboxamide |
| SMILES | CCOc1ccc(CCCNC(=O)C2CCN(Cc3nc(-c4ccc(Cl)cc4)no3)CC2)cc1 |
| InChI | InChI=1S/C26H31ClN4O3/c1-2-33-23-11-5-19(6-12-23)4-3-15-28-26(32)21-13-16-31(17-14-21)18-24-29-25(30-34-24)20-7-9-22(27)10-8-20/h5-12,21H,2-4,13-18H2,1H3,(H,28,32) |
| InChIKey | UOMGQBVHZMOYHJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|