C22H30ClN5O3 — CID 38157709
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide (PubChem CID 38157709) has the molecular formula C22H30ClN5O3 and a molecular weight of 447.97 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38157709 |
| Molecular Formula | C22H30ClN5O3 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)C1CCN(Cc2nc(-c3ccc(Cl)cc3)no2)CC1 |
| InChI | InChI=1S/C22H30ClN5O3/c23-19-4-2-17(3-5-19)21-25-20(31-26-21)16-28-10-6-18(7-11-28)22(29)24-8-1-9-27-12-14-30-15-13-27/h2-5,18H,1,6-16H2,(H,24,29) |
| InChIKey | MRDFZRNWCRXBFP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|