C17H13N5S2 — CID 3819092
5-cyano-2-pyridin-3-yl-4-pyridin-4-yl-6-sulfanyl-1,4-dihydropyridine-3-carbothioamide (PubChem CID 3819092) has the molecular formula C17H13N5S2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 5-cyano-2-pyridin-3-yl-4-pyridin-4-yl-6-sulfanyl-1,4-dihydropyridine-3-carbothioamide.
| Compound Name | 5-cyano-2-pyridin-3-yl-4-pyridin-4-yl-6-sulfanyl-1,4-dihydropyridine-3-carbothioamide |
|---|---|
| PubChem CID | 3819092 |
| Molecular Formula | C17H13N5S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 5-cyano-2-pyridin-3-yl-4-pyridin-4-yl-6-sulfanyl-1,4-dihydropyridine-3-carbothioamide |
| SMILES | N#CC1=C(S)NC(c2cccnc2)=C(C(N)=S)C1c1ccncc1 |
| InChI | InChI=1S/C17H13N5S2/c18-8-12-13(10-3-6-20-7-4-10)14(16(19)23)15(22-17(12)24)11-2-1-5-21-9-11/h1-7,9,13,22,24H,(H2,19,23) |
| InChIKey | UDPZGQPMDCRYTO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|