C18H14N6S2 — CID 51665913
(2S,3S,4R)-3,5-dicyano-2,4-dipyridin-3-yl-6-sulfanyl-2,4-dihydro-1H-pyridine-3-carbothioamide (PubChem CID 51665913) has the molecular formula C18H14N6S2 and a molecular weight of 378.49 g/mol. Its IUPAC name is (2S,3S,4R)-3,5-dicyano-2,4-dipyridin-3-yl-6-sulfanyl-2,4-dihydro-1H-pyridine-3-carbothioamide.
| Compound Name | (2S,3S,4R)-3,5-dicyano-2,4-dipyridin-3-yl-6-sulfanyl-2,4-dihydro-1H-pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 51665913 |
| Molecular Formula | C18H14N6S2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2S,3S,4R)-3,5-dicyano-2,4-dipyridin-3-yl-6-sulfanyl-2,4-dihydro-1H-pyridine-3-carbothioamide |
| SMILES | N#CC1=C(S)N[C@@H](c2cccnc2)[C@@](C#N)(C(N)=S)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C18H14N6S2/c19-7-13-14(11-3-1-5-22-8-11)18(10-20,17(21)26)15(24-16(13)25)12-4-2-6-23-9-12/h1-6,8-9,14-15,24-25H,(H2,21,26)/t14-,15+,18+/m1/s1 |
| InChIKey | OBBLUHIVXCKYME-VKJFTORMSA-N |
| XLogP | 2.37 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|