C24H28N4O3 — CID 38211150
(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone (PubChem CID 38211150) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone.
| Compound Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
|---|---|
| PubChem CID | 38211150 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(4-methyl-1,3,8-triazatricyclo[7.5.0.02,7]tetradeca-2,4,6,8-tetraen-6-yl)methanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1cc(C)nc3c1nc1n3CCCCC1)CC2 |
| InChI | InChI=1S/C24H28N4O3/c1-15-11-18(22-23(25-15)28-9-6-4-5-7-21(28)26-22)24(29)27-10-8-16-12-19(30-2)20(31-3)13-17(16)14-27/h11-13H,4-10,14H2,1-3H3 |
| InChIKey | QYVNSCZTLQIMFY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |