C33H30N4O2S — CID 3824084
N-[[4-(4-methoxyphenyl)-5-[2-(4-methylphenyl)-1-phenylethenyl]imino-1,2,4-thiadiazol-3-yl]methyl]-4-methylbenzamide (PubChem CID 3824084) has the molecular formula C33H30N4O2S and a molecular weight of 546.70 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)-5-[2-(4-methylphenyl)-1-phenylethenyl]imino-1,2,4-thiadiazol-3-yl]methyl]-4-methylbenzamide.
| Compound Name | N-[[4-(4-methoxyphenyl)-5-[2-(4-methylphenyl)-1-phenylethenyl]imino-1,2,4-thiadiazol-3-yl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3824084 |
| Molecular Formula | C33H30N4O2S |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)-5-[2-(4-methylphenyl)-1-phenylethenyl]imino-1,2,4-thiadiazol-3-yl]methyl]-4-methylbenzamide |
| SMILES | COc1ccc(-n2c(CNC(=O)c3ccc(C)cc3)ns/c2=N\C(=Cc2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30N4O2S/c1-23-9-13-25(14-10-23)21-30(26-7-5-4-6-8-26)35-33-37(28-17-19-29(39-3)20-18-28)31(36-40-33)22-34-32(38)27-15-11-24(2)12-16-27/h4-21H,22H2,1-3H3,(H,34,38)/b30-21?,35-33- |
| InChIKey | YOOSENRDTHDSNB-BWQXQEQWSA-N |
| XLogP | 6.59 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|