C24H24NO6+ — CID 3825117
[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methyl-4-oxochromen-7-yl] pyrrolidin-1-ium-2-carboxylate (PubChem CID 3825117) has the molecular formula C24H24NO6+ and a molecular weight of 422.46 g/mol. Its IUPAC name is [3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methyl-4-oxochromen-7-yl] pyrrolidin-1-ium-2-carboxylate.
| Compound Name | [3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methyl-4-oxochromen-7-yl] pyrrolidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 3825117 |
| Molecular Formula | C24H24NO6+ |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-methyl-4-oxochromen-7-yl] pyrrolidin-1-ium-2-carboxylate |
| SMILES | Cc1oc2cc(OC(=O)C3CCC[NH2+]3)ccc2c(=O)c1-c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H23NO6/c1-14-22(15-5-8-19-21(12-15)29-11-3-10-28-19)23(26)17-7-6-16(13-20(17)30-14)31-24(27)18-4-2-9-25-18/h5-8,12-13,18,25H,2-4,9-11H2,1H3/p+1 |
| InChIKey | IIWUQMDYQWUJCW-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|