C13H19N5O2 — CID 3825683
2-(1-aminopropyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazole-4-carboxamide (PubChem CID 3825683) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-(1-aminopropyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminopropyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3825683 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-(1-aminopropyl)-N-(3-imidazol-1-ylpropyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCC(N)c1nc(C(=O)NCCCn2ccnc2)co1 |
| InChI | InChI=1S/C13H19N5O2/c1-2-10(14)13-17-11(8-20-13)12(19)16-4-3-6-18-7-5-15-9-18/h5,7-10H,2-4,6,14H2,1H3,(H,16,19) |
| InChIKey | MZDFKJGCAGQBPD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|