C22H19F3N2O6S — CID 3826161
2-[5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[2-methoxy-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 3826161) has the molecular formula C22H19F3N2O6S and a molecular weight of 496.46 g/mol. Its IUPAC name is 2-[5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[2-methoxy-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[2-methoxy-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3826161 |
| Molecular Formula | C22H19F3N2O6S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 2-[5-[(2,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[2-methoxy-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3cc(C(F)(F)F)ccc3OC)C2=O)c(OC)c1 |
| InChI | InChI=1S/C22H19F3N2O6S/c1-31-14-6-4-12(17(10-14)33-3)8-18-20(29)27(21(30)34-18)11-19(28)26-15-9-13(22(23,24)25)5-7-16(15)32-2/h4-10H,11H2,1-3H3,(H,26,28) |
| InChIKey | GTXHTZPVEBVXPC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|