C22H18ClF3N2O5S — CID 2316889
N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide (PubChem CID 2316889) has the molecular formula C22H18ClF3N2O5S and a molecular weight of 514.91 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 2316889 |
| Molecular Formula | C22H18ClF3N2O5S |
| Molecular Weight | 514.91 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(5E)-5-[(3,4-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanamide |
| SMILES | COc1ccc(/C=C2/SC(=O)N(CCC(=O)Nc3cc(C(F)(F)F)ccc3Cl)C2=O)cc1OC |
| InChI | InChI=1S/C22H18ClF3N2O5S/c1-32-16-6-3-12(9-17(16)33-2)10-18-20(30)28(21(31)34-18)8-7-19(29)27-15-11-13(22(24,25)26)4-5-14(15)23/h3-6,9-11H,7-8H2,1-2H3,(H,27,29)/b18-10+ |
| InChIKey | OMPWKJZQZKUVPV-VCHYOVAHSA-N |
| XLogP | 5.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|