C17H23N3S2 — CID 3827341
1-[4-(diethylamino)phenyl]-3-(2-thiophen-2-ylethyl)thiourea (PubChem CID 3827341) has the molecular formula C17H23N3S2 and a molecular weight of 333.53 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(2-thiophen-2-ylethyl)thiourea.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(2-thiophen-2-ylethyl)thiourea |
|---|---|
| PubChem CID | 3827341 |
| Molecular Formula | C17H23N3S2 |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(2-thiophen-2-ylethyl)thiourea |
| SMILES | CCN(CC)c1ccc(NC(=S)NCCc2cccs2)cc1 |
| InChI | InChI=1S/C17H23N3S2/c1-3-20(4-2)15-9-7-14(8-10-15)19-17(21)18-12-11-16-6-5-13-22-16/h5-10,13H,3-4,11-12H2,1-2H3,(H2,18,19,21) |
| InChIKey | NXXJJZHYMCUADG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|