C19H33N3O2S — CID 3854982
1-(4,4-diethoxybutyl)-3-[4-(diethylamino)phenyl]thiourea (PubChem CID 3854982) has the molecular formula C19H33N3O2S and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-(4,4-diethoxybutyl)-3-[4-(diethylamino)phenyl]thiourea.
| Compound Name | 1-(4,4-diethoxybutyl)-3-[4-(diethylamino)phenyl]thiourea |
|---|---|
| PubChem CID | 3854982 |
| Molecular Formula | C19H33N3O2S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-(4,4-diethoxybutyl)-3-[4-(diethylamino)phenyl]thiourea |
| SMILES | CCOC(CCCNC(=S)Nc1ccc(N(CC)CC)cc1)OCC |
| InChI | InChI=1S/C19H33N3O2S/c1-5-22(6-2)17-13-11-16(12-14-17)21-19(25)20-15-9-10-18(23-7-3)24-8-4/h11-14,18H,5-10,15H2,1-4H3,(H2,20,21,25) |
| InChIKey | LTLZXDDNYYPPFO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|