C17H26N2O4S — CID 3310336
methyl 4-(4,4-diethoxybutylcarbamothioylamino)benzoate (PubChem CID 3310336) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 4-(4,4-diethoxybutylcarbamothioylamino)benzoate.
| Compound Name | methyl 4-(4,4-diethoxybutylcarbamothioylamino)benzoate |
|---|---|
| PubChem CID | 3310336 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 4-(4,4-diethoxybutylcarbamothioylamino)benzoate |
| SMILES | CCOC(CCCNC(=S)Nc1ccc(C(=O)OC)cc1)OCC |
| InChI | InChI=1S/C17H26N2O4S/c1-4-22-15(23-5-2)7-6-12-18-17(24)19-14-10-8-13(9-11-14)16(20)21-3/h8-11,15H,4-7,12H2,1-3H3,(H2,18,19,24) |
| InChIKey | NTMQJIIYIAWOCO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|