C20H29N3S3 — CID 9216601
1-[4-(diethylamino)phenyl]-3-(3-methylsulfanylpropyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 9216601) has the molecular formula C20H29N3S3 and a molecular weight of 407.67 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-(3-methylsulfanylpropyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-(3-methylsulfanylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9216601 |
| Molecular Formula | C20H29N3S3 |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-(3-methylsulfanylpropyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCN(CC)c1ccc(N(Cc2cccs2)C(=S)NCCCSC)cc1 |
| InChI | InChI=1S/C20H29N3S3/c1-4-22(5-2)17-9-11-18(12-10-17)23(16-19-8-6-15-26-19)20(24)21-13-7-14-25-3/h6,8-12,15H,4-5,7,13-14,16H2,1-3H3,(H,21,24) |
| InChIKey | VAOCSQOYJROCOU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|