C21H29N3OS2 — CID 9216580
1-[4-(diethylamino)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 9216580) has the molecular formula C21H29N3OS2 and a molecular weight of 403.62 g/mol. Its IUPAC name is 1-[4-(diethylamino)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[4-(diethylamino)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9216580 |
| Molecular Formula | C21H29N3OS2 |
| Molecular Weight | 403.62 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 1-[4-(diethylamino)phenyl]-3-[[(2R)-oxolan-2-yl]methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | CCN(CC)c1ccc(N(Cc2cccs2)C(=S)NC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H29N3OS2/c1-3-23(4-2)17-9-11-18(12-10-17)24(16-20-8-6-14-27-20)21(26)22-15-19-7-5-13-25-19/h6,8-12,14,19H,3-5,7,13,15-16H2,1-2H3,(H,22,26)/t19-/m1/s1 |
| InChIKey | ZLPFTLHIMIDKHR-LJQANCHMSA-N |
| XLogP | 4.65 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|