C21H16F3NO3S — CID 38274579
N-methyl-2-(thiophene-2-carbonyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide (PubChem CID 38274579) has the molecular formula C21H16F3NO3S and a molecular weight of 419.42 g/mol. Its IUPAC name is N-methyl-2-(thiophene-2-carbonyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide.
| Compound Name | N-methyl-2-(thiophene-2-carbonyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 38274579 |
| Molecular Formula | C21H16F3NO3S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-methyl-2-(thiophene-2-carbonyl)-N-[[2-(trifluoromethoxy)phenyl]methyl]benzamide |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)C(=O)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C21H16F3NO3S/c1-25(13-14-7-2-5-10-17(14)28-21(22,23)24)20(27)16-9-4-3-8-15(16)19(26)18-11-6-12-29-18/h2-12H,13H2,1H3 |
| InChIKey | KJADAQFECUIBDO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |