C24H24N2O2S — CID 78817110
N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]-2-(thiophene-2-carbonyl)benzamide (PubChem CID 78817110) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]-2-(thiophene-2-carbonyl)benzamide.
| Compound Name | N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]-2-(thiophene-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 78817110 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-methyl-N-[(2-pyrrolidin-1-ylphenyl)methyl]-2-(thiophene-2-carbonyl)benzamide |
| SMILES | CN(Cc1ccccc1N1CCCC1)C(=O)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C24H24N2O2S/c1-25(17-18-9-2-5-12-21(18)26-14-6-7-15-26)24(28)20-11-4-3-10-19(20)23(27)22-13-8-16-29-22/h2-5,8-13,16H,6-7,14-15,17H2,1H3 |
| InChIKey | CACKJESZFQDLNT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |