C17H14N2O2S — CID 38285207
N-(1,3-benzothiazol-2-ylmethyl)-2-(4-methylphenyl)-2-oxoacetamide (PubChem CID 38285207) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-2-(4-methylphenyl)-2-oxoacetamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(4-methylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 38285207 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-2-(4-methylphenyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C(=O)C(=O)NCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H14N2O2S/c1-11-6-8-12(9-7-11)16(20)17(21)18-10-15-19-13-4-2-3-5-14(13)22-15/h2-9H,10H2,1H3,(H,18,21) |
| InChIKey | AKFYDGTYBRMIKW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|