C24H29N3O3S — CID 166185334
N'-(1,3-benzothiazol-2-ylmethyl)-N-[[4-methyl-2-(4-methylpentan-2-yloxy)phenyl]methyl]oxamide (PubChem CID 166185334) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N'-(1,3-benzothiazol-2-ylmethyl)-N-[[4-methyl-2-(4-methylpentan-2-yloxy)phenyl]methyl]oxamide.
| Compound Name | N'-(1,3-benzothiazol-2-ylmethyl)-N-[[4-methyl-2-(4-methylpentan-2-yloxy)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 166185334 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N'-(1,3-benzothiazol-2-ylmethyl)-N-[[4-methyl-2-(4-methylpentan-2-yloxy)phenyl]methyl]oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)NCc2nc3ccccc3s2)c(OC(C)CC(C)C)c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-15(2)11-17(4)30-20-12-16(3)9-10-18(20)13-25-23(28)24(29)26-14-22-27-19-7-5-6-8-21(19)31-22/h5-10,12,15,17H,11,13-14H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | UHIKIVCSBIJGTG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|