C20H33ClN2O2 — CID 3829758
3-(4-chlorophenyl)-3-(pentylamino)-2-[(pentylamino)methyl]propanoic acid (PubChem CID 3829758) has the molecular formula C20H33ClN2O2 and a molecular weight of 368.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(pentylamino)-2-[(pentylamino)methyl]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-(pentylamino)-2-[(pentylamino)methyl]propanoic acid |
|---|---|
| PubChem CID | 3829758 |
| Molecular Formula | C20H33ClN2O2 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(pentylamino)-2-[(pentylamino)methyl]propanoic acid |
| SMILES | CCCCCNCC(C(=O)O)C(NCCCCC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H33ClN2O2/c1-3-5-7-13-22-15-18(20(24)25)19(23-14-8-6-4-2)16-9-11-17(21)12-10-16/h9-12,18-19,22-23H,3-8,13-15H2,1-2H3,(H,24,25) |
| InChIKey | QEGUOBXJWXTRTR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|