C22H27Cl2NO — CID 94469742
(2R)-1,2-bis(4-chlorophenyl)-2-(octylamino)ethanone (PubChem CID 94469742) has the molecular formula C22H27Cl2NO and a molecular weight of 392.37 g/mol. Its IUPAC name is (2R)-1,2-bis(4-chlorophenyl)-2-(octylamino)ethanone.
| Compound Name | (2R)-1,2-bis(4-chlorophenyl)-2-(octylamino)ethanone |
|---|---|
| PubChem CID | 94469742 |
| Molecular Formula | C22H27Cl2NO |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2R)-1,2-bis(4-chlorophenyl)-2-(octylamino)ethanone |
| SMILES | CCCCCCCCN[C@@H](C(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27Cl2NO/c1-2-3-4-5-6-7-16-25-21(17-8-12-19(23)13-9-17)22(26)18-10-14-20(24)15-11-18/h8-15,21,25H,2-7,16H2,1H3/t21-/m1/s1 |
| InChIKey | TUZKPWGHNMHLGC-OAQYLSRUSA-N |
| XLogP | 6.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|