C13H25N3O4S — CID 38311387
1-(1-methylsulfonylpiperidin-4-yl)-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea (PubChem CID 38311387) has the molecular formula C13H25N3O4S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-4-yl)-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 38311387 |
| Molecular Formula | C13H25N3O4S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]urea |
| SMILES | C[C@@H](NC(=O)NC1CCN(S(C)(=O)=O)CC1)[C@H]1CCCO1 |
| InChI | InChI=1S/C13H25N3O4S/c1-10(12-4-3-9-20-12)14-13(17)15-11-5-7-16(8-6-11)21(2,18)19/h10-12H,3-9H2,1-2H3,(H2,14,15,17)/t10-,12-/m1/s1 |
| InChIKey | RTPOAHDGPXDURK-ZYHUDNBSSA-N |
| XLogP | 0.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |