C25H24ClN3O3S — CID 3832132
2-[5-tert-butyl-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 3832132) has the molecular formula C25H24ClN3O3S and a molecular weight of 482.01 g/mol. Its IUPAC name is 2-[5-tert-butyl-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-[5-tert-butyl-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 3832132 |
| Molecular Formula | C25H24ClN3O3S |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 2-[5-tert-butyl-3-(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7-yl]sulfanyl-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | Cc1nn2c(SCC(=O)c3ccc(O)c(O)c3)cc(C(C)(C)C)nc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O3S/c1-14-23(15-5-8-17(26)9-6-15)24-27-21(25(2,3)4)12-22(29(24)28-14)33-13-20(32)16-7-10-18(30)19(31)11-16/h5-12,30-31H,13H2,1-4H3 |
| InChIKey | MSNMWNSWTAAMLC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|