C14H10Cl2O3S — CID 43218405
2-(2,5-dichlorophenyl)sulfanyl-1-(3,4-dihydroxyphenyl)ethanone (PubChem CID 43218405) has the molecular formula C14H10Cl2O3S and a molecular weight of 329.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanyl-1-(3,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanyl-1-(3,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 43218405 |
| Molecular Formula | C14H10Cl2O3S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanyl-1-(3,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CSc1cc(Cl)ccc1Cl)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H10Cl2O3S/c15-9-2-3-10(16)14(6-9)20-7-13(19)8-1-4-11(17)12(18)5-8/h1-6,17-18H,7H2 |
| InChIKey | ZJHVBYBAYKNRDU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|