C24H26N2O3S — CID 3833542
1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-[2-(phenoxymethyl)-1,3-thiazol-4-yl]pyrrole-3-carboxylic acid (PubChem CID 3833542) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-[2-(phenoxymethyl)-1,3-thiazol-4-yl]pyrrole-3-carboxylic acid.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-[2-(phenoxymethyl)-1,3-thiazol-4-yl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3833542 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-[2-(phenoxymethyl)-1,3-thiazol-4-yl]pyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(-c2csc(COc3ccccc3)n2)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C24H26N2O3S/c1-17-20(24(27)28)14-22(26(17)13-12-18-8-4-2-5-9-18)21-16-30-23(25-21)15-29-19-10-6-3-7-11-19/h3,6-8,10-11,14,16H,2,4-5,9,12-13,15H2,1H3,(H,27,28) |
| InChIKey | FHNCCIHPPYFDPN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|