C21H26FN3O4S — CID 38336408
4-(2,4-dimethylphenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide (PubChem CID 38336408) has the molecular formula C21H26FN3O4S and a molecular weight of 435.52 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethylphenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 38336408 |
| Molecular Formula | C21H26FN3O4S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-(2,4-dimethylphenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)NCCOc3cccc(F)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26FN3O4S/c1-16-6-7-20(17(2)14-16)30(27,28)25-11-9-24(10-12-25)21(26)23-8-13-29-19-5-3-4-18(22)15-19/h3-7,14-15H,8-13H2,1-2H3,(H,23,26) |
| InChIKey | MBXCXIQPQVGYGW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|