C19H20Cl2FN3O4S — CID 38336469
4-(2,3-dichlorophenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide (PubChem CID 38336469) has the molecular formula C19H20Cl2FN3O4S and a molecular weight of 476.36 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,3-dichlorophenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 38336469 |
| Molecular Formula | C19H20Cl2FN3O4S |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 4-(2,3-dichlorophenyl)sulfonyl-N-[2-(3-fluorophenoxy)ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCOc1cccc(F)c1)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C19H20Cl2FN3O4S/c20-16-5-2-6-17(18(16)21)30(27,28)25-10-8-24(9-11-25)19(26)23-7-12-29-15-4-1-3-14(22)13-15/h1-6,13H,7-12H2,(H,23,26) |
| InChIKey | RIWHCDJFZWVERU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|