C17H14BrN7S — CID 3834937
1-[1-(benzotriazol-1-ylmethyl)pyrazol-4-yl]-3-(2-bromophenyl)thiourea (PubChem CID 3834937) has the molecular formula C17H14BrN7S and a molecular weight of 428.32 g/mol. Its IUPAC name is 1-[1-(benzotriazol-1-ylmethyl)pyrazol-4-yl]-3-(2-bromophenyl)thiourea.
| Compound Name | 1-[1-(benzotriazol-1-ylmethyl)pyrazol-4-yl]-3-(2-bromophenyl)thiourea |
|---|---|
| PubChem CID | 3834937 |
| Molecular Formula | C17H14BrN7S |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 1-[1-(benzotriazol-1-ylmethyl)pyrazol-4-yl]-3-(2-bromophenyl)thiourea |
| SMILES | S=C(Nc1cnn(Cn2nnc3ccccc32)c1)Nc1ccccc1Br |
| InChI | InChI=1S/C17H14BrN7S/c18-13-5-1-2-6-14(13)21-17(26)20-12-9-19-24(10-12)11-25-16-8-4-3-7-15(16)22-23-25/h1-10H,11H2,(H2,20,21,26) |
| InChIKey | OKVWGIPMCDLRFL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|