C20H30O5 — CID 38357282
(4S)-4-acetyloxy-8-[3-oxo-2-[(E)-pent-2-enyl]cyclopenten-1-yl]octanoic acid (PubChem CID 38357282) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (4S)-4-acetyloxy-8-[3-oxo-2-[(E)-pent-2-enyl]cyclopenten-1-yl]octanoic acid.
| Compound Name | (4S)-4-acetyloxy-8-[3-oxo-2-[(E)-pent-2-enyl]cyclopenten-1-yl]octanoic acid |
|---|---|
| PubChem CID | 38357282 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (4S)-4-acetyloxy-8-[3-oxo-2-[(E)-pent-2-enyl]cyclopenten-1-yl]octanoic acid |
| SMILES | CC/C=C/CC1=C(CCCC[C@@H](CCC(=O)O)OC(C)=O)CCC1=O |
| InChI | InChI=1S/C20H30O5/c1-3-4-5-10-18-16(11-13-19(18)22)8-6-7-9-17(25-15(2)21)12-14-20(23)24/h4-5,17H,3,6-14H2,1-2H3,(H,23,24)/b5-4+/t17-/m0/s1 |
| InChIKey | QWDCJWDUPSTHHK-BDUNBXCCSA-N |
| XLogP | 4.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|