C17H28O7 — CID 38360170
(2E,6E)-9-[(2S,3R,4S,5R)-3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl]-2,6-dimethylnona-2,6-dienoic acid (PubChem CID 38360170) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is (2E,6E)-9-[(2S,3R,4S,5R)-3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl]-2,6-dimethylnona-2,6-dienoic acid.
| Compound Name | (2E,6E)-9-[(2S,3R,4S,5R)-3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl]-2,6-dimethylnona-2,6-dienoic acid |
|---|---|
| PubChem CID | 38360170 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2E,6E)-9-[(2S,3R,4S,5R)-3,4-dihydroxy-2,5-dimethoxyoxolan-3-yl]-2,6-dimethylnona-2,6-dienoic acid |
| SMILES | CO[C@@H]1O[C@H](OC)[C@@](O)(CC/C=C(\C)CC/C=C(\C)C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C17H28O7/c1-11(7-5-9-12(2)14(19)20)8-6-10-17(21)13(18)15(22-3)24-16(17)23-4/h8-9,13,15-16,18,21H,5-7,10H2,1-4H3,(H,19,20)/b11-8+,12-9+/t13-,15-,16+,17-/m1/s1 |
| InChIKey | UZEPTXOLRZFMEM-XBPOTBMESA-N |
| XLogP | 1.59 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|