C22H25ClF3NO3S — CID 3841970
1-(4-butylphenyl)sulfonyl-4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol (PubChem CID 3841970) has the molecular formula C22H25ClF3NO3S and a molecular weight of 475.96 g/mol. Its IUPAC name is 1-(4-butylphenyl)sulfonyl-4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol.
| Compound Name | 1-(4-butylphenyl)sulfonyl-4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 3841970 |
| Molecular Formula | C22H25ClF3NO3S |
| Molecular Weight | 475.96 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1-(4-butylphenyl)sulfonyl-4-[4-chloro-3-(trifluoromethyl)phenyl]piperidin-4-ol |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CCC(O)(c3ccc(Cl)c(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H25ClF3NO3S/c1-2-3-4-16-5-8-18(9-6-16)31(29,30)27-13-11-21(28,12-14-27)17-7-10-20(23)19(15-17)22(24,25)26/h5-10,15,28H,2-4,11-14H2,1H3 |
| InChIKey | HRJFTKWGIJTHOM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |